About methyl 5-(3,5-dimethoxyphenyl)piperidine-3-carboxylate;hydrochloride
methyl 5-(3,5-dimethoxyphenyl)piperidine-3-carboxylate;hydrochloride (PubChem CID 91798796) has the molecular formula C15H22ClNO4
and a molecular weight of 315.80 g/mol. Its IUPAC name is methyl 5-(3,5-dimethoxyphenyl)piperidine-3-carboxylate;hydrochloride.
Molecular Properties
| Compound Name | methyl 5-(3,5-dimethoxyphenyl)piperidine-3-carboxylate;hydrochloride |
| PubChem CID | 91798796 |
| Molecular Formula | C15H22ClNO4 |
| Molecular Weight | 315.80 g/mol |
| Exact Mass | 315.12 |
| IUPAC Name | methyl 5-(3,5-dimethoxyphenyl)piperidine-3-carboxylate;hydrochloride |
| SMILES | COC(=O)C1CNCC(c2cc(OC)cc(OC)c2)C1.Cl |
| InChI | InChI=1S/C15H21NO4.ClH/c1-18-13-5-10(6-14(7-13)19-2)11-4-12(9-16-8-11)15(17)20-3;/h5-7,11-12,16H,4,8-9H2,1-3H3;1H |
| InChIKey | TZUIBJIOUMTKLJ-UHFFFAOYSA-N |
| XLogP | 1.99 |
| TPSA | 56.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 315.80 |
| LogP ≤ 5 | 1.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze methyl 5-(3,5-dimethoxyphenyl)piperidine-3-carboxylate;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl 5-(3,5-dimethoxyphenyl)piperidine-3-carboxylate;hydrochloride?
The IUPAC name of methyl 5-(3,5-dimethoxyphenyl)piperidine-3-carboxylate;hydrochloride (CID 91798796) is methyl 5-(3,5-dimethoxyphenyl)piperidine-3-carboxylate;hydrochloride.
What is the SMILES notation for methyl 5-(3,5-dimethoxyphenyl)piperidine-3-carboxylate;hydrochloride?
The canonical SMILES for methyl 5-(3,5-dimethoxyphenyl)piperidine-3-carboxylate;hydrochloride is COC(=O)C1CNCC(c2cc(OC)cc(OC)c2)C1.Cl.
What is the InChIKey of methyl 5-(3,5-dimethoxyphenyl)piperidine-3-carboxylate;hydrochloride?
The InChIKey is TZUIBJIOUMTKLJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H21NO4.ClH/c1-18-13-5-10(6-14(7-13)19-2)11-4-12(9-16-8-11)15(17)20-3;/h5-7,11-12,16H,4,8-9H2,1-3H3;1H.
What are the key properties of methyl 5-(3,5-dimethoxyphenyl)piperidine-3-carboxylate;hydrochloride?
methyl 5-(3,5-dimethoxyphenyl)piperidine-3-carboxylate;hydrochloride has a molecular weight of 315.80 g/mol, XLogP of 1.99, 4 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 5-(3,5-dimethoxyphenyl)piperidine-3-carboxylate;hydrochloride is sourced from PubChem (CID 91798796), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).