C16H18N2O3S2 — CID 9179911
4-(ethylsulfamoyl)-N-(4-methylsulfanylphenyl)benzamide (PubChem CID 9179911) has the molecular formula C16H18N2O3S2 and a molecular weight of 350.47 g/mol. Its IUPAC name is 4-(ethylsulfamoyl)-N-(4-methylsulfanylphenyl)benzamide.
| Compound Name | 4-(ethylsulfamoyl)-N-(4-methylsulfanylphenyl)benzamide |
|---|---|
| PubChem CID | 9179911 |
| Molecular Formula | C16H18N2O3S2 |
| Molecular Weight | 350.47 g/mol |
| Exact Mass | 350.08 |
| IUPAC Name | 4-(ethylsulfamoyl)-N-(4-methylsulfanylphenyl)benzamide |
| SMILES | CCNS(=O)(=O)c1ccc(C(=O)Nc2ccc(SC)cc2)cc1 |
| InChI | InChI=1S/C16H18N2O3S2/c1-3-17-23(20,21)15-10-4-12(5-11-15)16(19)18-13-6-8-14(22-2)9-7-13/h4-11,17H,3H2,1-2H3,(H,18,19) |
| InChIKey | DOPUPRSOAGOLTC-UHFFFAOYSA-N |
| XLogP | 2.96 |
| TPSA | 75.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.47 |
| LogP ≤ 5 | 2.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |