C34H50O4 — CID 91799314
bis[2-[(1R,3S,4S)-4-ethenyl-4-methyl-3-prop-1-en-2-ylcyclohexyl]prop-2-enyl] butanedioate (PubChem CID 91799314) has the molecular formula C34H50O4 and a molecular weight of 522.77 g/mol. Its IUPAC name is bis[2-[(1R,3S,4S)-4-ethenyl-4-methyl-3-prop-1-en-2-ylcyclohexyl]prop-2-enyl] butanedioate.
| Compound Name | bis[2-[(1R,3S,4S)-4-ethenyl-4-methyl-3-prop-1-en-2-ylcyclohexyl]prop-2-enyl] butanedioate |
|---|---|
| PubChem CID | 91799314 |
| Molecular Formula | C34H50O4 |
| Molecular Weight | 522.77 g/mol |
| Exact Mass | 522.37 |
| IUPAC Name | bis[2-[(1R,3S,4S)-4-ethenyl-4-methyl-3-prop-1-en-2-ylcyclohexyl]prop-2-enyl] butanedioate |
| SMILES | C=C[C@]1(C)CC[C@@H](C(=C)COC(=O)CCC(=O)OCC(=C)[C@@H]2CC[C@@](C)(C=C)[C@H](C(=C)C)C2)C[C@H]1C(=C)C |
| InChI | InChI=1S/C34H50O4/c1-11-33(9)17-15-27(19-29(33)23(3)4)25(7)21-37-31(35)13-14-32(36)38-22-26(8)28-16-18-34(10,12-2)30(20-28)24(5)6/h11-12,27-30H,1-3,5,7-8,13-22H2,4,6,9-10H3/t27-,28-,29+,30+,33-,34-/m1/s1 |
| InChIKey | IPBQUJWAPZFPEL-IYNZBFDPSA-N |
| XLogP | 8.33 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 522.77 |
| LogP ≤ 5 | 8.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|