C21H19FN6O — CID 91799412
3-cyclopropyl-5-[5-(2-fluorophenyl)-7-methylimidazo[5,1-f][1,2,4]triazin-4-yl]-6,7-dihydro-4H-[1,2]oxazolo[4,3-c]pyridine (PubChem CID 91799412) has the molecular formula C21H19FN6O and a molecular weight of 390.42 g/mol. Its IUPAC name is 3-cyclopropyl-5-[5-(2-fluorophenyl)-7-methylimidazo[5,1-f][1,2,4]triazin-4-yl]-6,7-dihydro-4H-[1,2]oxazolo[4,3-c]pyridine.
| Compound Name | 3-cyclopropyl-5-[5-(2-fluorophenyl)-7-methylimidazo[5,1-f][1,2,4]triazin-4-yl]-6,7-dihydro-4H-[1,2]oxazolo[4,3-c]pyridine |
|---|---|
| PubChem CID | 91799412 |
| Molecular Formula | C21H19FN6O |
| Molecular Weight | 390.42 g/mol |
| Exact Mass | 390.16 |
| IUPAC Name | 3-cyclopropyl-5-[5-(2-fluorophenyl)-7-methylimidazo[5,1-f][1,2,4]triazin-4-yl]-6,7-dihydro-4H-[1,2]oxazolo[4,3-c]pyridine |
| SMILES | Cc1nc(-c2ccccc2F)c2c(N3CCc4noc(C5CC5)c4C3)ncnn12 |
| InChI | InChI=1S/C21H19FN6O/c1-12-25-18(14-4-2-3-5-16(14)22)19-21(23-11-24-28(12)19)27-9-8-17-15(10-27)20(29-26-17)13-6-7-13/h2-5,11,13H,6-10H2,1H3 |
| InChIKey | OKQIQXMDRFQMTE-UHFFFAOYSA-N |
| XLogP | 3.67 |
| TPSA | 72.35 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.42 |
| LogP ≤ 5 | 3.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |