C22H22FN7 — CID 91799433
6-[5-(2-fluorophenyl)-7-methylimidazo[5,1-f][1,2,4]triazin-4-yl]-N,N-dimethyl-7,8-dihydro-5H-1,6-naphthyridin-2-amine (PubChem CID 91799433) has the molecular formula C22H22FN7 and a molecular weight of 403.47 g/mol. Its IUPAC name is 6-[5-(2-fluorophenyl)-7-methylimidazo[5,1-f][1,2,4]triazin-4-yl]-N,N-dimethyl-7,8-dihydro-5H-1,6-naphthyridin-2-amine.
| Compound Name | 6-[5-(2-fluorophenyl)-7-methylimidazo[5,1-f][1,2,4]triazin-4-yl]-N,N-dimethyl-7,8-dihydro-5H-1,6-naphthyridin-2-amine |
|---|---|
| PubChem CID | 91799433 |
| Molecular Formula | C22H22FN7 |
| Molecular Weight | 403.47 g/mol |
| Exact Mass | 403.19 |
| IUPAC Name | 6-[5-(2-fluorophenyl)-7-methylimidazo[5,1-f][1,2,4]triazin-4-yl]-N,N-dimethyl-7,8-dihydro-5H-1,6-naphthyridin-2-amine |
| SMILES | Cc1nc(-c2ccccc2F)c2c(N3CCc4nc(N(C)C)ccc4C3)ncnn12 |
| InChI | InChI=1S/C22H22FN7/c1-14-26-20(16-6-4-5-7-17(16)23)21-22(24-13-25-30(14)21)29-11-10-18-15(12-29)8-9-19(27-18)28(2)3/h4-9,13H,10-12H2,1-3H3 |
| InChIKey | DGVFBFRPVFJGKQ-UHFFFAOYSA-N |
| XLogP | 3.26 |
| TPSA | 62.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.47 |
| LogP ≤ 5 | 3.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |