C18H23N7O — CID 91799467
4-(2,3-dimethyl-6,7-dihydro-4H-pyrazolo[4,3-c]pyridin-5-yl)-7-methyl-5-[(3S)-oxolan-3-yl]imidazo[5,1-f][1,2,4]triazine (PubChem CID 91799467) has the molecular formula C18H23N7O and a molecular weight of 353.43 g/mol. Its IUPAC name is 4-(2,3-dimethyl-6,7-dihydro-4H-pyrazolo[4,3-c]pyridin-5-yl)-7-methyl-5-[(3S)-oxolan-3-yl]imidazo[5,1-f][1,2,4]triazine.
| Compound Name | 4-(2,3-dimethyl-6,7-dihydro-4H-pyrazolo[4,3-c]pyridin-5-yl)-7-methyl-5-[(3S)-oxolan-3-yl]imidazo[5,1-f][1,2,4]triazine |
|---|---|
| PubChem CID | 91799467 |
| Molecular Formula | C18H23N7O |
| Molecular Weight | 353.43 g/mol |
| Exact Mass | 353.20 |
| IUPAC Name | 4-(2,3-dimethyl-6,7-dihydro-4H-pyrazolo[4,3-c]pyridin-5-yl)-7-methyl-5-[(3S)-oxolan-3-yl]imidazo[5,1-f][1,2,4]triazine |
| SMILES | Cc1c2c(nn1C)CCN(c1ncnn3c(C)nc([C@@H]4CCOC4)c13)C2 |
| InChI | InChI=1S/C18H23N7O/c1-11-14-8-24(6-4-15(14)22-23(11)3)18-17-16(13-5-7-26-9-13)21-12(2)25(17)20-10-19-18/h10,13H,4-9H2,1-3H3/t13-/m1/s1 |
| InChIKey | UZCOQOQWVWREAA-CYBMUJFWSA-N |
| XLogP | 1.54 |
| TPSA | 73.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.43 |
| LogP ≤ 5 | 1.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |