C20H20FN7 — CID 91799481
4-(1,3-dimethyl-6,7-dihydro-4H-pyrazolo[4,5-c]pyridin-5-yl)-5-(2-fluorophenyl)-7-methylimidazo[5,1-f][1,2,4]triazine (PubChem CID 91799481) has the molecular formula C20H20FN7 and a molecular weight of 377.43 g/mol. Its IUPAC name is 4-(1,3-dimethyl-6,7-dihydro-4H-pyrazolo[4,5-c]pyridin-5-yl)-5-(2-fluorophenyl)-7-methylimidazo[5,1-f][1,2,4]triazine.
| Compound Name | 4-(1,3-dimethyl-6,7-dihydro-4H-pyrazolo[4,5-c]pyridin-5-yl)-5-(2-fluorophenyl)-7-methylimidazo[5,1-f][1,2,4]triazine |
|---|---|
| PubChem CID | 91799481 |
| Molecular Formula | C20H20FN7 |
| Molecular Weight | 377.43 g/mol |
| Exact Mass | 377.18 |
| IUPAC Name | 4-(1,3-dimethyl-6,7-dihydro-4H-pyrazolo[4,5-c]pyridin-5-yl)-5-(2-fluorophenyl)-7-methylimidazo[5,1-f][1,2,4]triazine |
| SMILES | Cc1nn(C)c2c1CN(c1ncnn3c(C)nc(-c4ccccc4F)c13)CC2 |
| InChI | InChI=1S/C20H20FN7/c1-12-15-10-27(9-8-17(15)26(3)25-12)20-19-18(14-6-4-5-7-16(14)21)24-13(2)28(19)23-11-22-20/h4-7,11H,8-10H2,1-3H3 |
| InChIKey | NMBOADHXCHYWOE-UHFFFAOYSA-N |
| XLogP | 2.84 |
| TPSA | 64.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.43 |
| LogP ≤ 5 | 2.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |