C11H18N2OS — CID 9179994
N',N',5-trimethyl-4-propylthiophene-2-carbohydrazide (PubChem CID 9179994) has the molecular formula C11H18N2OS and a molecular weight of 226.34 g/mol. Its IUPAC name is N',N',5-trimethyl-4-propylthiophene-2-carbohydrazide.
| Compound Name | N',N',5-trimethyl-4-propylthiophene-2-carbohydrazide |
|---|---|
| PubChem CID | 9179994 |
| Molecular Formula | C11H18N2OS |
| Molecular Weight | 226.34 g/mol |
| Exact Mass | 226.11 |
| IUPAC Name | N',N',5-trimethyl-4-propylthiophene-2-carbohydrazide |
| SMILES | CCCc1cc(C(=O)NN(C)C)sc1C |
| InChI | InChI=1S/C11H18N2OS/c1-5-6-9-7-10(15-8(9)2)11(14)12-13(3)4/h7H,5-6H2,1-4H3,(H,12,14) |
| InChIKey | GRCHGGFTUCRHGL-UHFFFAOYSA-N |
| XLogP | 2.22 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 226.34 |
| LogP ≤ 5 | 2.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|