C14H20BF2NO2 — CID 91800382
6-butyl-2-(2,4-difluorophenyl)-1,3,6,2-dioxazaborocane (PubChem CID 91800382) has the molecular formula C14H20BF2NO2 and a molecular weight of 283.13 g/mol. Its IUPAC name is 6-butyl-2-(2,4-difluorophenyl)-1,3,6,2-dioxazaborocane.
| Compound Name | 6-butyl-2-(2,4-difluorophenyl)-1,3,6,2-dioxazaborocane |
|---|---|
| PubChem CID | 91800382 |
| Molecular Formula | C14H20BF2NO2 |
| Molecular Weight | 283.13 g/mol |
| Exact Mass | 283.16 |
| IUPAC Name | 6-butyl-2-(2,4-difluorophenyl)-1,3,6,2-dioxazaborocane |
| SMILES | CCCCN1CCOB(c2ccc(F)cc2F)OCC1 |
| InChI | InChI=1S/C14H20BF2NO2/c1-2-3-6-18-7-9-19-15(20-10-8-18)13-5-4-12(16)11-14(13)17/h4-5,11H,2-3,6-10H2,1H3 |
| InChIKey | TVKNBFFXRJYTMU-UHFFFAOYSA-N |
| XLogP | 1.81 |
| TPSA | 21.70 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.13 |
| LogP ≤ 5 | 1.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|