C15H17BFNO3 — CID 91800509
[2-fluoro-5-[[(4-methoxyphenyl)methylamino]methyl]phenyl]boronic acid (PubChem CID 91800509) has the molecular formula C15H17BFNO3 and a molecular weight of 289.12 g/mol. Its IUPAC name is [2-fluoro-5-[[(4-methoxyphenyl)methylamino]methyl]phenyl]boronic acid.
| Compound Name | [2-fluoro-5-[[(4-methoxyphenyl)methylamino]methyl]phenyl]boronic acid |
|---|---|
| PubChem CID | 91800509 |
| Molecular Formula | C15H17BFNO3 |
| Molecular Weight | 289.12 g/mol |
| Exact Mass | 289.13 |
| IUPAC Name | [2-fluoro-5-[[(4-methoxyphenyl)methylamino]methyl]phenyl]boronic acid |
| SMILES | COc1ccc(CNCc2ccc(F)c(B(O)O)c2)cc1 |
| InChI | InChI=1S/C15H17BFNO3/c1-21-13-5-2-11(3-6-13)9-18-10-12-4-7-15(17)14(8-12)16(19)20/h2-8,18-20H,9-10H2,1H3 |
| InChIKey | ZKFIGZKBIRDVKD-UHFFFAOYSA-N |
| XLogP | 0.80 |
| TPSA | 61.72 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.12 |
| LogP ≤ 5 | 0.80 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|