C23H24N6O3S — CID 91800613
1-[[4-(diethylsulfamoyl)phenyl]methyl]-N-pyrimidin-4-ylindazole-3-carboxamide (PubChem CID 91800613) has the molecular formula C23H24N6O3S and a molecular weight of 464.55 g/mol. Its IUPAC name is 1-[[4-(diethylsulfamoyl)phenyl]methyl]-N-pyrimidin-4-ylindazole-3-carboxamide.
| Compound Name | 1-[[4-(diethylsulfamoyl)phenyl]methyl]-N-pyrimidin-4-ylindazole-3-carboxamide |
|---|---|
| PubChem CID | 91800613 |
| Molecular Formula | C23H24N6O3S |
| Molecular Weight | 464.55 g/mol |
| Exact Mass | 464.16 |
| IUPAC Name | 1-[[4-(diethylsulfamoyl)phenyl]methyl]-N-pyrimidin-4-ylindazole-3-carboxamide |
| SMILES | CCN(CC)S(=O)(=O)c1ccc(Cn2nc(C(=O)Nc3ccncn3)c3ccccc32)cc1 |
| InChI | InChI=1S/C23H24N6O3S/c1-3-28(4-2)33(31,32)18-11-9-17(10-12-18)15-29-20-8-6-5-7-19(20)22(27-29)23(30)26-21-13-14-24-16-25-21/h5-14,16H,3-4,15H2,1-2H3,(H,24,25,26,30) |
| InChIKey | FQWCTSFVJUCDMS-UHFFFAOYSA-N |
| XLogP | 3.16 |
| TPSA | 110.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.55 |
| LogP ≤ 5 | 3.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |