C27H29N5O2 — CID 91801169
4-(4-ethylpiperazin-1-yl)-N-[6-(3-methoxyphenyl)-1H-indazol-3-yl]benzamide (PubChem CID 91801169) has the molecular formula C27H29N5O2 and a molecular weight of 455.56 g/mol. Its IUPAC name is 4-(4-ethylpiperazin-1-yl)-N-[6-(3-methoxyphenyl)-1H-indazol-3-yl]benzamide.
| Compound Name | 4-(4-ethylpiperazin-1-yl)-N-[6-(3-methoxyphenyl)-1H-indazol-3-yl]benzamide |
|---|---|
| PubChem CID | 91801169 |
| Molecular Formula | C27H29N5O2 |
| Molecular Weight | 455.56 g/mol |
| Exact Mass | 455.23 |
| IUPAC Name | 4-(4-ethylpiperazin-1-yl)-N-[6-(3-methoxyphenyl)-1H-indazol-3-yl]benzamide |
| SMILES | CCN1CCN(c2ccc(C(=O)Nc3n[nH]c4cc(-c5cccc(OC)c5)ccc34)cc2)CC1 |
| InChI | InChI=1S/C27H29N5O2/c1-3-31-13-15-32(16-14-31)22-10-7-19(8-11-22)27(33)28-26-24-12-9-21(18-25(24)29-30-26)20-5-4-6-23(17-20)34-2/h4-12,17-18H,3,13-16H2,1-2H3,(H2,28,29,30,33) |
| InChIKey | LDEZCHXBGZHBFD-UHFFFAOYSA-N |
| XLogP | 4.63 |
| TPSA | 73.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 455.56 |
| LogP ≤ 5 | 4.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |