C16H22O6 — CID 91801303
(3aR,4R,6S,7S,7aR)-4-methoxy-7-(methoxymethoxy)-6-methyl-2-phenyl-4,6,7,7a-tetrahydro-3aH-[1,3]dioxolo[4,5-c]pyran (PubChem CID 91801303) has the molecular formula C16H22O6 and a molecular weight of 310.35 g/mol. Its IUPAC name is (3aR,4R,6S,7S,7aR)-4-methoxy-7-(methoxymethoxy)-6-methyl-2-phenyl-4,6,7,7a-tetrahydro-3aH-[1,3]dioxolo[4,5-c]pyran.
| Compound Name | (3aR,4R,6S,7S,7aR)-4-methoxy-7-(methoxymethoxy)-6-methyl-2-phenyl-4,6,7,7a-tetrahydro-3aH-[1,3]dioxolo[4,5-c]pyran |
|---|---|
| PubChem CID | 91801303 |
| Molecular Formula | C16H22O6 |
| Molecular Weight | 310.35 g/mol |
| Exact Mass | 310.14 |
| IUPAC Name | (3aR,4R,6S,7S,7aR)-4-methoxy-7-(methoxymethoxy)-6-methyl-2-phenyl-4,6,7,7a-tetrahydro-3aH-[1,3]dioxolo[4,5-c]pyran |
| SMILES | COCO[C@@H]1[C@H]2OC(c3ccccc3)O[C@H]2[C@H](OC)O[C@H]1C |
| InChI | InChI=1S/C16H22O6/c1-10-12(19-9-17-2)13-14(16(18-3)20-10)22-15(21-13)11-7-5-4-6-8-11/h4-8,10,12-16H,9H2,1-3H3/t10-,12-,13+,14+,15?,16+/m0/s1 |
| InChIKey | IAOGXGFCGBYCGQ-CJIPBLCVSA-N |
| XLogP | 1.85 |
| TPSA | 55.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.35 |
| LogP ≤ 5 | 1.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|