About 7-ethenyl-1,4-dioxaspiro[4.5]dec-7-ene
7-ethenyl-1,4-dioxaspiro[4.5]dec-7-ene (PubChem CID 91801305) has the molecular formula C10H14O2
and a molecular weight of 166.22 g/mol. Its IUPAC name is 7-ethenyl-1,4-dioxaspiro[4.5]dec-7-ene.
Molecular Properties
| Compound Name | 7-ethenyl-1,4-dioxaspiro[4.5]dec-7-ene |
| PubChem CID | 91801305 |
| Molecular Formula | C10H14O2 |
| Molecular Weight | 166.22 g/mol |
| Exact Mass | 166.10 |
| IUPAC Name | 7-ethenyl-1,4-dioxaspiro[4.5]dec-7-ene |
| SMILES | C=CC1=CCCC2(C1)OCCO2 |
| InChI | InChI=1S/C10H14O2/c1-2-9-4-3-5-10(8-9)11-6-7-12-10/h2,4H,1,3,5-8H2 |
| InChIKey | BWHZBPGJEYTRBY-UHFFFAOYSA-N |
| XLogP | 2.03 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 166.22 |
| LogP ≤ 5 | 2.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 7-ethenyl-1,4-dioxaspiro[4.5]dec-7-ene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 7-ethenyl-1,4-dioxaspiro[4.5]dec-7-ene?
The IUPAC name of 7-ethenyl-1,4-dioxaspiro[4.5]dec-7-ene (CID 91801305) is 7-ethenyl-1,4-dioxaspiro[4.5]dec-7-ene.
What is the SMILES notation for 7-ethenyl-1,4-dioxaspiro[4.5]dec-7-ene?
The canonical SMILES for 7-ethenyl-1,4-dioxaspiro[4.5]dec-7-ene is C=CC1=CCCC2(C1)OCCO2.
What is the InChIKey of 7-ethenyl-1,4-dioxaspiro[4.5]dec-7-ene?
The InChIKey is BWHZBPGJEYTRBY-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H14O2/c1-2-9-4-3-5-10(8-9)11-6-7-12-10/h2,4H,1,3,5-8H2.
What are the key properties of 7-ethenyl-1,4-dioxaspiro[4.5]dec-7-ene?
7-ethenyl-1,4-dioxaspiro[4.5]dec-7-ene has a molecular weight of 166.22 g/mol, XLogP of 2.03, 1 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 7-ethenyl-1,4-dioxaspiro[4.5]dec-7-ene is sourced from PubChem (CID 91801305), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).