C28H32F3N2O4S- — CID 91801407
1-[3-[[5-[cyclopropyl(sulfinato)amino]-2,2-dimethyl-3H-1-benzofuran-7-yl]oxy]propyl]-4-[3-(trifluoromethyl)phenyl]-3,6-dihydro-2H-pyridine (PubChem CID 91801407) has the molecular formula C28H32F3N2O4S- and a molecular weight of 549.64 g/mol. Its IUPAC name is 1-[3-[[5-[cyclopropyl(sulfinato)amino]-2,2-dimethyl-3H-1-benzofuran-7-yl]oxy]propyl]-4-[3-(trifluoromethyl)phenyl]-3,6-dihydro-2H-pyridine.
| Compound Name | 1-[3-[[5-[cyclopropyl(sulfinato)amino]-2,2-dimethyl-3H-1-benzofuran-7-yl]oxy]propyl]-4-[3-(trifluoromethyl)phenyl]-3,6-dihydro-2H-pyridine |
|---|---|
| PubChem CID | 91801407 |
| Molecular Formula | C28H32F3N2O4S- |
| Molecular Weight | 549.64 g/mol |
| Exact Mass | 549.20 |
| IUPAC Name | 1-[3-[[5-[cyclopropyl(sulfinato)amino]-2,2-dimethyl-3H-1-benzofuran-7-yl]oxy]propyl]-4-[3-(trifluoromethyl)phenyl]-3,6-dihydro-2H-pyridine |
| SMILES | CC1(C)Cc2cc(N(C3CC3)S(=O)[O-])cc(OCCCN3CC=C(c4cccc(C(F)(F)F)c4)CC3)c2O1 |
| InChI | InChI=1S/C28H33F3N2O4S/c1-27(2)18-21-16-24(33(38(34)35)23-7-8-23)17-25(26(21)37-27)36-14-4-11-32-12-9-19(10-13-32)20-5-3-6-22(15-20)28(29,30)31/h3,5-6,9,15-17,23H,4,7-8,10-14,18H2,1-2H3,(H,34,35)/p-1 |
| InChIKey | ISVMUHDCILFMAN-UHFFFAOYSA-M |
| XLogP | 5.74 |
| TPSA | 65.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 549.64 |
| LogP ≤ 5 | 5.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'sulfinic_acid', 'substructure': 'N/A'} |
|---|