About methyl 6-nitrohexa-2,3-dienoate;methyl prop-2-enoate;4-nitrobutanal
methyl 6-nitrohexa-2,3-dienoate;methyl prop-2-enoate;4-nitrobutanal (PubChem CID 91801456) has the molecular formula C15H22N2O9
and a molecular weight of 374.35 g/mol. Its IUPAC name is methyl 6-nitrohexa-2,3-dienoate;methyl prop-2-enoate;4-nitrobutanal.
Molecular Properties
| Compound Name | methyl 6-nitrohexa-2,3-dienoate;methyl prop-2-enoate;4-nitrobutanal |
| PubChem CID | 91801456 |
| Molecular Formula | C15H22N2O9 |
| Molecular Weight | 374.35 g/mol |
| Exact Mass | 374.13 |
| IUPAC Name | methyl 6-nitrohexa-2,3-dienoate;methyl prop-2-enoate;4-nitrobutanal |
| SMILES | C=CC(=O)OC.COC(=O)C=C=CCC[N+](=O)[O-].O=CCCC[N+](=O)[O-] |
| InChI | InChI=1S/C7H9NO4.C4H7NO3.C4H6O2/c1-12-7(9)5-3-2-4-6-8(10)11;6-4-2-1-3-5(7)8;1-3-4(5)6-2/h2,5H,4,6H2,1H3;4H,1-3H2;3H,1H2,2H3 |
| InChIKey | CKQMISCTFZXKEY-UHFFFAOYSA-N |
| XLogP | 1.13 |
| TPSA | 155.95 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 374.35 |
| LogP ≤ 5 | 1.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze methyl 6-nitrohexa-2,3-dienoate;methyl prop-2-enoate;4-nitrobutanal with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl 6-nitrohexa-2,3-dienoate;methyl prop-2-enoate;4-nitrobutanal?
The IUPAC name of methyl 6-nitrohexa-2,3-dienoate;methyl prop-2-enoate;4-nitrobutanal (CID 91801456) is methyl 6-nitrohexa-2,3-dienoate;methyl prop-2-enoate;4-nitrobutanal.
What is the SMILES notation for methyl 6-nitrohexa-2,3-dienoate;methyl prop-2-enoate;4-nitrobutanal?
The canonical SMILES for methyl 6-nitrohexa-2,3-dienoate;methyl prop-2-enoate;4-nitrobutanal is C=CC(=O)OC.COC(=O)C=C=CCC[N+](=O)[O-].O=CCCC[N+](=O)[O-].
What is the InChIKey of methyl 6-nitrohexa-2,3-dienoate;methyl prop-2-enoate;4-nitrobutanal?
The InChIKey is CKQMISCTFZXKEY-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H9NO4.C4H7NO3.C4H6O2/c1-12-7(9)5-3-2-4-6-8(10)11;6-4-2-1-3-5(7)8;1-3-4(5)6-2/h2,5H,4,6H2,1H3;4H,1-3H2;3H,1H2,2H3.
What are the key properties of methyl 6-nitrohexa-2,3-dienoate;methyl prop-2-enoate;4-nitrobutanal?
methyl 6-nitrohexa-2,3-dienoate;methyl prop-2-enoate;4-nitrobutanal has a molecular weight of 374.35 g/mol, XLogP of 1.13, 9 rotatable bonds, 0 hydrogen bond donors, and 9 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 6-nitrohexa-2,3-dienoate;methyl prop-2-enoate;4-nitrobutanal is sourced from PubChem (CID 91801456), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).