About 2-fluoro-5-(1H-1,2,4-triazol-5-yl)pyridine
2-fluoro-5-(1H-1,2,4-triazol-5-yl)pyridine (PubChem CID 91801574) has the molecular formula C7H5FN4
and a molecular weight of 164.14 g/mol. Its IUPAC name is 2-fluoro-5-(1H-1,2,4-triazol-5-yl)pyridine.
Molecular Properties
| Compound Name | 2-fluoro-5-(1H-1,2,4-triazol-5-yl)pyridine |
| PubChem CID | 91801574 |
| Molecular Formula | C7H5FN4 |
| Molecular Weight | 164.14 g/mol |
| Exact Mass | 164.05 |
| IUPAC Name | 2-fluoro-5-(1H-1,2,4-triazol-5-yl)pyridine |
| SMILES | Fc1ccc(-c2ncn[nH]2)cn1 |
| InChI | InChI=1S/C7H5FN4/c8-6-2-1-5(3-9-6)7-10-4-11-12-7/h1-4H,(H,10,11,12) |
| InChIKey | FEVIISCISAZVAE-UHFFFAOYSA-N |
| XLogP | 1.01 |
| TPSA | 54.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 164.14 |
| LogP ≤ 5 | 1.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|
Analyze 2-fluoro-5-(1H-1,2,4-triazol-5-yl)pyridine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-fluoro-5-(1H-1,2,4-triazol-5-yl)pyridine?
The IUPAC name of 2-fluoro-5-(1H-1,2,4-triazol-5-yl)pyridine (CID 91801574) is 2-fluoro-5-(1H-1,2,4-triazol-5-yl)pyridine.
What is the SMILES notation for 2-fluoro-5-(1H-1,2,4-triazol-5-yl)pyridine?
The canonical SMILES for 2-fluoro-5-(1H-1,2,4-triazol-5-yl)pyridine is Fc1ccc(-c2ncn[nH]2)cn1.
What is the InChIKey of 2-fluoro-5-(1H-1,2,4-triazol-5-yl)pyridine?
The InChIKey is FEVIISCISAZVAE-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H5FN4/c8-6-2-1-5(3-9-6)7-10-4-11-12-7/h1-4H,(H,10,11,12).
What are the key properties of 2-fluoro-5-(1H-1,2,4-triazol-5-yl)pyridine?
2-fluoro-5-(1H-1,2,4-triazol-5-yl)pyridine has a molecular weight of 164.14 g/mol, XLogP of 1.01, 1 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-fluoro-5-(1H-1,2,4-triazol-5-yl)pyridine is sourced from PubChem (CID 91801574), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).