C10H14F5NO — CID 91801576
(Z)-4-[(dimethylamino)methyl]-1,1,1,2,2-pentafluorohept-4-en-3-one (PubChem CID 91801576) has the molecular formula C10H14F5NO and a molecular weight of 259.22 g/mol. Its IUPAC name is (Z)-4-[(dimethylamino)methyl]-1,1,1,2,2-pentafluorohept-4-en-3-one.
| Compound Name | (Z)-4-[(dimethylamino)methyl]-1,1,1,2,2-pentafluorohept-4-en-3-one |
|---|---|
| PubChem CID | 91801576 |
| Molecular Formula | C10H14F5NO |
| Molecular Weight | 259.22 g/mol |
| Exact Mass | 259.10 |
| IUPAC Name | (Z)-4-[(dimethylamino)methyl]-1,1,1,2,2-pentafluorohept-4-en-3-one |
| SMILES | CC/C=C(/CN(C)C)C(=O)C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C10H14F5NO/c1-4-5-7(6-16(2)3)8(17)9(11,12)10(13,14)15/h5H,4,6H2,1-3H3/b7-5- |
| InChIKey | DQMRFIAXBCKGCP-ALCCZGGFSA-N |
| XLogP | 2.65 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 259.22 |
| LogP ≤ 5 | 2.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|