About N,N-dimethyl-2-(1,3-thiazol-5-ylsulfanyl)ethanamine
N,N-dimethyl-2-(1,3-thiazol-5-ylsulfanyl)ethanamine (PubChem CID 91801644) has the molecular formula C7H12N2S2
and a molecular weight of 188.32 g/mol. Its IUPAC name is N,N-dimethyl-2-(1,3-thiazol-5-ylsulfanyl)ethanamine.
Molecular Properties
| Compound Name | N,N-dimethyl-2-(1,3-thiazol-5-ylsulfanyl)ethanamine |
| PubChem CID | 91801644 |
| Molecular Formula | C7H12N2S2 |
| Molecular Weight | 188.32 g/mol |
| Exact Mass | 188.04 |
| IUPAC Name | N,N-dimethyl-2-(1,3-thiazol-5-ylsulfanyl)ethanamine |
| SMILES | CN(C)CCSc1cncs1 |
| InChI | InChI=1S/C7H12N2S2/c1-9(2)3-4-10-7-5-8-6-11-7/h5-6H,3-4H2,1-2H3 |
| InChIKey | HWWJMYFVAQKTAJ-UHFFFAOYSA-N |
| XLogP | 1.80 |
| TPSA | 16.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 188.32 |
| LogP ≤ 5 | 1.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze N,N-dimethyl-2-(1,3-thiazol-5-ylsulfanyl)ethanamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N,N-dimethyl-2-(1,3-thiazol-5-ylsulfanyl)ethanamine?
The IUPAC name of N,N-dimethyl-2-(1,3-thiazol-5-ylsulfanyl)ethanamine (CID 91801644) is N,N-dimethyl-2-(1,3-thiazol-5-ylsulfanyl)ethanamine.
What is the SMILES notation for N,N-dimethyl-2-(1,3-thiazol-5-ylsulfanyl)ethanamine?
The canonical SMILES for N,N-dimethyl-2-(1,3-thiazol-5-ylsulfanyl)ethanamine is CN(C)CCSc1cncs1.
What is the InChIKey of N,N-dimethyl-2-(1,3-thiazol-5-ylsulfanyl)ethanamine?
The InChIKey is HWWJMYFVAQKTAJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H12N2S2/c1-9(2)3-4-10-7-5-8-6-11-7/h5-6H,3-4H2,1-2H3.
What are the key properties of N,N-dimethyl-2-(1,3-thiazol-5-ylsulfanyl)ethanamine?
N,N-dimethyl-2-(1,3-thiazol-5-ylsulfanyl)ethanamine has a molecular weight of 188.32 g/mol, XLogP of 1.80, 4 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for N,N-dimethyl-2-(1,3-thiazol-5-ylsulfanyl)ethanamine is sourced from PubChem (CID 91801644), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).