About 19-methyltricosa-1,2-diene
19-methyltricosa-1,2-diene (PubChem CID 91801678) has the molecular formula C24H46
and a molecular weight of 334.63 g/mol. Its IUPAC name is 19-methyltricosa-1,2-diene.
Molecular Properties
| Compound Name | 19-methyltricosa-1,2-diene |
| PubChem CID | 91801678 |
| Molecular Formula | C24H46 |
| Molecular Weight | 334.63 g/mol |
| Exact Mass | 334.36 |
| IUPAC Name | 19-methyltricosa-1,2-diene |
| SMILES | C=C=CCCCCCCCCCCCCCCCC(C)CCCC |
| InChI | InChI=1S/C24H46/c1-4-6-8-9-10-11-12-13-14-15-16-17-18-19-20-21-23-24(3)22-7-5-2/h6,24H,1,5,7-23H2,2-3H3 |
| InChIKey | XXMSQDLYGJUPJB-UHFFFAOYSA-N |
| XLogP | 9.01 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 19 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 334.63 |
| LogP ≤ 5 | 9.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 19-methyltricosa-1,2-diene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 19-methyltricosa-1,2-diene?
The IUPAC name of 19-methyltricosa-1,2-diene (CID 91801678) is 19-methyltricosa-1,2-diene.
What is the SMILES notation for 19-methyltricosa-1,2-diene?
The canonical SMILES for 19-methyltricosa-1,2-diene is C=C=CCCCCCCCCCCCCCCCC(C)CCCC.
What is the InChIKey of 19-methyltricosa-1,2-diene?
The InChIKey is XXMSQDLYGJUPJB-UHFFFAOYSA-N. The full InChI is InChI=1S/C24H46/c1-4-6-8-9-10-11-12-13-14-15-16-17-18-19-20-21-23-24(3)22-7-5-2/h6,24H,1,5,7-23H2,2-3H3.
What are the key properties of 19-methyltricosa-1,2-diene?
19-methyltricosa-1,2-diene has a molecular weight of 334.63 g/mol, XLogP of 9.01, 19 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 19-methyltricosa-1,2-diene is sourced from PubChem (CID 91801678), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).