C20H42NO2S- — CID 91802071
6-[3,7-dimethyloctan-3-yl(sulfinato)amino]-2,6-dimethyloctane (PubChem CID 91802071) has the molecular formula C20H42NO2S- and a molecular weight of 360.63 g/mol. Its IUPAC name is 6-[3,7-dimethyloctan-3-yl(sulfinato)amino]-2,6-dimethyloctane.
| Compound Name | 6-[3,7-dimethyloctan-3-yl(sulfinato)amino]-2,6-dimethyloctane |
|---|---|
| PubChem CID | 91802071 |
| Molecular Formula | C20H42NO2S- |
| Molecular Weight | 360.63 g/mol |
| Exact Mass | 360.29 |
| IUPAC Name | 6-[3,7-dimethyloctan-3-yl(sulfinato)amino]-2,6-dimethyloctane |
| SMILES | CCC(C)(CCCC(C)C)N(S(=O)[O-])C(C)(CC)CCCC(C)C |
| InChI | InChI=1S/C20H43NO2S/c1-9-19(7,15-11-13-17(3)4)21(24(22)23)20(8,10-2)16-12-14-18(5)6/h17-18H,9-16H2,1-8H3,(H,22,23)/p-1 |
| InChIKey | HNQUITHIIGNYIV-UHFFFAOYSA-M |
| XLogP | 6.07 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.63 |
| LogP ≤ 5 | 6.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'sulfinic_acid', 'substructure': 'N/A'} |
|---|