C8H2F10N2 — CID 91802215
2,4-bis(1,1,2,2,2-pentafluoroethyl)pyrimidine (PubChem CID 91802215) has the molecular formula C8H2F10N2 and a molecular weight of 316.10 g/mol. Its IUPAC name is 2,4-bis(1,1,2,2,2-pentafluoroethyl)pyrimidine.
| Compound Name | 2,4-bis(1,1,2,2,2-pentafluoroethyl)pyrimidine |
|---|---|
| PubChem CID | 91802215 |
| Molecular Formula | C8H2F10N2 |
| Molecular Weight | 316.10 g/mol |
| Exact Mass | 316.01 |
| IUPAC Name | 2,4-bis(1,1,2,2,2-pentafluoroethyl)pyrimidine |
| SMILES | FC(F)(F)C(F)(F)c1ccnc(C(F)(F)C(F)(F)F)n1 |
| InChI | InChI=1S/C8H2F10N2/c9-5(10,7(13,14)15)3-1-2-19-4(20-3)6(11,12)8(16,17)18/h1-2H |
| InChIKey | BQXLUBLIWCSHDR-UHFFFAOYSA-N |
| XLogP | 3.78 |
| TPSA | 25.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.10 |
| LogP ≤ 5 | 3.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|