C23H19N10S+ — CID 91802537
2-(1-phenyl-2-pyrazin-2-yl-4-pyridin-2-yl-3-pyrimidin-2-yltetrazolidin-1-ium-1-yl)-1,3-thiazole (PubChem CID 91802537) has the molecular formula C23H19N10S+ and a molecular weight of 467.54 g/mol. Its IUPAC name is 2-(1-phenyl-2-pyrazin-2-yl-4-pyridin-2-yl-3-pyrimidin-2-yltetrazolidin-1-ium-1-yl)-1,3-thiazole.
| Compound Name | 2-(1-phenyl-2-pyrazin-2-yl-4-pyridin-2-yl-3-pyrimidin-2-yltetrazolidin-1-ium-1-yl)-1,3-thiazole |
|---|---|
| PubChem CID | 91802537 |
| Molecular Formula | C23H19N10S+ |
| Molecular Weight | 467.54 g/mol |
| Exact Mass | 467.15 |
| IUPAC Name | 2-(1-phenyl-2-pyrazin-2-yl-4-pyridin-2-yl-3-pyrimidin-2-yltetrazolidin-1-ium-1-yl)-1,3-thiazole |
| SMILES | c1ccc([N+]2(c3nccs3)CN(c3ccccn3)N(c3ncccn3)N2c2cnccn2)cc1 |
| InChI | InChI=1S/C23H19N10S/c1-2-7-19(8-3-1)33(23-29-15-16-34-23)18-30(20-9-4-5-10-25-20)31(22-27-11-6-12-28-22)32(33)21-17-24-13-14-26-21/h1-17H,18H2/q+1 |
| InChIKey | FLPKPRZPHNRXKA-UHFFFAOYSA-N |
| XLogP | 3.99 |
| TPSA | 87.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 467.54 |
| LogP ≤ 5 | 3.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|