C21H28FN2+ — CID 91803071
1-[6-(2-fluorophenyl)-2-methylcycloocta-1,5,7-trien-1-yl]-1,4-dimethylpiperazin-1-ium (PubChem CID 91803071) has the molecular formula C21H28FN2+ and a molecular weight of 327.47 g/mol. Its IUPAC name is 1-[6-(2-fluorophenyl)-2-methylcycloocta-1,5,7-trien-1-yl]-1,4-dimethylpiperazin-1-ium.
| Compound Name | 1-[6-(2-fluorophenyl)-2-methylcycloocta-1,5,7-trien-1-yl]-1,4-dimethylpiperazin-1-ium |
|---|---|
| PubChem CID | 91803071 |
| Molecular Formula | C21H28FN2+ |
| Molecular Weight | 327.47 g/mol |
| Exact Mass | 327.22 |
| IUPAC Name | 1-[6-(2-fluorophenyl)-2-methylcycloocta-1,5,7-trien-1-yl]-1,4-dimethylpiperazin-1-ium |
| SMILES | CC1=C([N+]2(C)CCN(C)CC2)C=CC(c2ccccc2F)=CCC1 |
| InChI | InChI=1S/C21H28FN2/c1-17-7-6-8-18(19-9-4-5-10-20(19)22)11-12-21(17)24(3)15-13-23(2)14-16-24/h4-5,8-12H,6-7,13-16H2,1-3H3/q+1 |
| InChIKey | ZHWPEXQYVYTHGD-UHFFFAOYSA-N |
| XLogP | 4.23 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.47 |
| LogP ≤ 5 | 4.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|