C17H29N3O10 — CID 91803380
(4R)-4-[[(2S)-2-[2-[(2S,3R,4R,5S,6R)-3-amino-2,5-dihydroxy-6-(hydroxymethyl)oxan-4-yl]oxypropanoylamino]propanoyl]amino]-5-oxopentanoic acid (PubChem CID 91803380) has the molecular formula C17H29N3O10 and a molecular weight of 435.43 g/mol. Its IUPAC name is (4R)-4-[[(2S)-2-[2-[(2S,3R,4R,5S,6R)-3-amino-2,5-dihydroxy-6-(hydroxymethyl)oxan-4-yl]oxypropanoylamino]propanoyl]amino]-5-oxopentanoic acid.
| Compound Name | (4R)-4-[[(2S)-2-[2-[(2S,3R,4R,5S,6R)-3-amino-2,5-dihydroxy-6-(hydroxymethyl)oxan-4-yl]oxypropanoylamino]propanoyl]amino]-5-oxopentanoic acid |
|---|---|
| PubChem CID | 91803380 |
| Molecular Formula | C17H29N3O10 |
| Molecular Weight | 435.43 g/mol |
| Exact Mass | 435.19 |
| IUPAC Name | (4R)-4-[[(2S)-2-[2-[(2S,3R,4R,5S,6R)-3-amino-2,5-dihydroxy-6-(hydroxymethyl)oxan-4-yl]oxypropanoylamino]propanoyl]amino]-5-oxopentanoic acid |
| SMILES | CC(O[C@@H]1[C@@H](N)[C@@H](O)O[C@H](CO)[C@H]1O)C(=O)N[C@@H](C)C(=O)N[C@@H](C=O)CCC(=O)O |
| InChI | InChI=1S/C17H29N3O10/c1-7(15(26)20-9(5-21)3-4-11(23)24)19-16(27)8(2)29-14-12(18)17(28)30-10(6-22)13(14)25/h5,7-10,12-14,17,22,25,28H,3-4,6,18H2,1-2H3,(H,19,27)(H,20,26)(H,23,24)/t7-,8?,9+,10+,12+,13+,14+,17-/m0/s1 |
| InChIKey | NPORSGYVQKUTRN-ABRCDPJPSA-N |
| XLogP | -3.79 |
| TPSA | 217.74 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.43 |
| LogP ≤ 5 | -3.79 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|