C19H22F3NO5 — CID 91803409
[2-[3-(tert-butylcarbamoyl)-2,5,6-trifluorophenoxy]-3,6-dihydro-2H-pyran-6-yl]methyl acetate (PubChem CID 91803409) has the molecular formula C19H22F3NO5 and a molecular weight of 401.38 g/mol. Its IUPAC name is [2-[3-(tert-butylcarbamoyl)-2,5,6-trifluorophenoxy]-3,6-dihydro-2H-pyran-6-yl]methyl acetate.
| Compound Name | [2-[3-(tert-butylcarbamoyl)-2,5,6-trifluorophenoxy]-3,6-dihydro-2H-pyran-6-yl]methyl acetate |
|---|---|
| PubChem CID | 91803409 |
| Molecular Formula | C19H22F3NO5 |
| Molecular Weight | 401.38 g/mol |
| Exact Mass | 401.15 |
| IUPAC Name | [2-[3-(tert-butylcarbamoyl)-2,5,6-trifluorophenoxy]-3,6-dihydro-2H-pyran-6-yl]methyl acetate |
| SMILES | CC(=O)OCC1C=CCC(Oc2c(F)c(F)cc(C(=O)NC(C)(C)C)c2F)O1 |
| InChI | InChI=1S/C19H22F3NO5/c1-10(24)26-9-11-6-5-7-14(27-11)28-17-15(21)12(8-13(20)16(17)22)18(25)23-19(2,3)4/h5-6,8,11,14H,7,9H2,1-4H3,(H,23,25) |
| InChIKey | BKWOLCDFAAEXET-UHFFFAOYSA-N |
| XLogP | 3.25 |
| TPSA | 73.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.38 |
| LogP ≤ 5 | 3.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|