C29H28ClNO4S — CID 91803683
[1-[3-[2-(7-chloroquinolin-2-yl)ethenyl]phenyl]-3-[2-(2-hydroxypropan-2-yl)phenyl]propyl] hydrogen sulfite (PubChem CID 91803683) has the molecular formula C29H28ClNO4S and a molecular weight of 522.07 g/mol. Its IUPAC name is [1-[3-[2-(7-chloroquinolin-2-yl)ethenyl]phenyl]-3-[2-(2-hydroxypropan-2-yl)phenyl]propyl] hydrogen sulfite.
| Compound Name | [1-[3-[2-(7-chloroquinolin-2-yl)ethenyl]phenyl]-3-[2-(2-hydroxypropan-2-yl)phenyl]propyl] hydrogen sulfite |
|---|---|
| PubChem CID | 91803683 |
| Molecular Formula | C29H28ClNO4S |
| Molecular Weight | 522.07 g/mol |
| Exact Mass | 521.14 |
| IUPAC Name | [1-[3-[2-(7-chloroquinolin-2-yl)ethenyl]phenyl]-3-[2-(2-hydroxypropan-2-yl)phenyl]propyl] hydrogen sulfite |
| SMILES | CC(C)(O)c1ccccc1CCC(OS(=O)O)c1cccc(C=Cc2ccc3ccc(Cl)cc3n2)c1 |
| InChI | InChI=1S/C29H28ClNO4S/c1-29(2,32)26-9-4-3-7-21(26)13-17-28(35-36(33)34)23-8-5-6-20(18-23)10-15-25-16-12-22-11-14-24(30)19-27(22)31-25/h3-12,14-16,18-19,28,32H,13,17H2,1-2H3,(H,33,34) |
| InChIKey | XTKPNPBYTMCMCW-UHFFFAOYSA-N |
| XLogP | 7.11 |
| TPSA | 79.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 522.07 |
| LogP ≤ 5 | 7.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'sulfinic_acid', 'substructure': 'N/A'} |
|---|