About N-octan-4-ylpentanamide
N-octan-4-ylpentanamide (PubChem CID 91803774) has the molecular formula C13H27NO
and a molecular weight of 213.36 g/mol. Its IUPAC name is N-octan-4-ylpentanamide.
Molecular Properties
| Compound Name | N-octan-4-ylpentanamide |
| PubChem CID | 91803774 |
| Molecular Formula | C13H27NO |
| Molecular Weight | 213.36 g/mol |
| Exact Mass | 213.21 |
| IUPAC Name | N-octan-4-ylpentanamide |
| SMILES | CCCCC(=O)NC(CCC)CCCC |
| InChI | InChI=1S/C13H27NO/c1-4-7-10-12(9-6-3)14-13(15)11-8-5-2/h12H,4-11H2,1-3H3,(H,14,15) |
| InChIKey | OWRSHLUVUIHKNA-UHFFFAOYSA-N |
| XLogP | 3.65 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 213.36 |
| LogP ≤ 5 | 3.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze N-octan-4-ylpentanamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-octan-4-ylpentanamide?
The IUPAC name of N-octan-4-ylpentanamide (CID 91803774) is N-octan-4-ylpentanamide.
What is the SMILES notation for N-octan-4-ylpentanamide?
The canonical SMILES for N-octan-4-ylpentanamide is CCCCC(=O)NC(CCC)CCCC.
What is the InChIKey of N-octan-4-ylpentanamide?
The InChIKey is OWRSHLUVUIHKNA-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H27NO/c1-4-7-10-12(9-6-3)14-13(15)11-8-5-2/h12H,4-11H2,1-3H3,(H,14,15).
What are the key properties of N-octan-4-ylpentanamide?
N-octan-4-ylpentanamide has a molecular weight of 213.36 g/mol, XLogP of 3.65, 9 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for N-octan-4-ylpentanamide is sourced from PubChem (CID 91803774), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).