C6H3N3S3 — CID 91804052
[1,2,5]thiadiazolo[3,4-f][1,3,2]benzodithiazole (PubChem CID 91804052) has the molecular formula C6H3N3S3 and a molecular weight of 213.31 g/mol. Its IUPAC name is [1,2,5]thiadiazolo[3,4-f][1,3,2]benzodithiazole.
| Compound Name | [1,2,5]thiadiazolo[3,4-f][1,3,2]benzodithiazole |
|---|---|
| PubChem CID | 91804052 |
| Molecular Formula | C6H3N3S3 |
| Molecular Weight | 213.31 g/mol |
| Exact Mass | 212.95 |
| IUPAC Name | [1,2,5]thiadiazolo[3,4-f][1,3,2]benzodithiazole |
| SMILES | c1c2c(cc3nsnc13)SNS2 |
| InChI | InChI=1S/C6H3N3S3/c1-3-4(8-12-7-3)2-6-5(1)10-9-11-6/h1-2,9H |
| InChIKey | LOOXTZDRIDLRNN-UHFFFAOYSA-N |
| XLogP | 2.31 |
| TPSA | 37.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 213.31 |
| LogP ≤ 5 | 2.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|