C10H14N2 — CID 91804071
1,2,3,4,4a,10a-hexahydrocycloocta[d]pyrimidine (PubChem CID 91804071) has the molecular formula C10H14N2 and a molecular weight of 162.24 g/mol. Its IUPAC name is 1,2,3,4,4a,10a-hexahydrocycloocta[d]pyrimidine.
| Compound Name | 1,2,3,4,4a,10a-hexahydrocycloocta[d]pyrimidine |
|---|---|
| PubChem CID | 91804071 |
| Molecular Formula | C10H14N2 |
| Molecular Weight | 162.24 g/mol |
| Exact Mass | 162.12 |
| IUPAC Name | 1,2,3,4,4a,10a-hexahydrocycloocta[d]pyrimidine |
| SMILES | C1=CC=CC2NCNCC2C=C1 |
| InChI | InChI=1S/C10H14N2/c1-2-4-6-10-9(5-3-1)7-11-8-12-10/h1-6,9-12H,7-8H2 |
| InChIKey | AOAYJJZQXJWQAI-UHFFFAOYSA-N |
| XLogP | 0.80 |
| TPSA | 24.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 162.24 |
| LogP ≤ 5 | 0.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |