C18H24N4O3 — CID 9180457
methyl 3-[1-[4-(dimethylaminocarbamoyl)phenyl]-3,5-dimethylpyrazol-4-yl]propanoate (PubChem CID 9180457) has the molecular formula C18H24N4O3 and a molecular weight of 344.42 g/mol. Its IUPAC name is methyl 3-[1-[4-(dimethylaminocarbamoyl)phenyl]-3,5-dimethylpyrazol-4-yl]propanoate.
| Compound Name | methyl 3-[1-[4-(dimethylaminocarbamoyl)phenyl]-3,5-dimethylpyrazol-4-yl]propanoate |
|---|---|
| PubChem CID | 9180457 |
| Molecular Formula | C18H24N4O3 |
| Molecular Weight | 344.42 g/mol |
| Exact Mass | 344.18 |
| IUPAC Name | methyl 3-[1-[4-(dimethylaminocarbamoyl)phenyl]-3,5-dimethylpyrazol-4-yl]propanoate |
| SMILES | COC(=O)CCc1c(C)nn(-c2ccc(C(=O)NN(C)C)cc2)c1C |
| InChI | InChI=1S/C18H24N4O3/c1-12-16(10-11-17(23)25-5)13(2)22(19-12)15-8-6-14(7-9-15)18(24)20-21(3)4/h6-9H,10-11H2,1-5H3,(H,20,24) |
| InChIKey | AQJUMTJDKDTKAC-UHFFFAOYSA-N |
| XLogP | 1.80 |
| TPSA | 76.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.42 |
| LogP ≤ 5 | 1.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|