C13H19N2+ — CID 91804573
3-hexa-1,3,4,5-tetraenyl-2-methyl-1,4,5,6,7,8-hexahydro-1,3-diazocin-3-ium (PubChem CID 91804573) has the molecular formula C13H19N2+ and a molecular weight of 203.31 g/mol. Its IUPAC name is 3-hexa-1,3,4,5-tetraenyl-2-methyl-1,4,5,6,7,8-hexahydro-1,3-diazocin-3-ium.
| Compound Name | 3-hexa-1,3,4,5-tetraenyl-2-methyl-1,4,5,6,7,8-hexahydro-1,3-diazocin-3-ium |
|---|---|
| PubChem CID | 91804573 |
| Molecular Formula | C13H19N2+ |
| Molecular Weight | 203.31 g/mol |
| Exact Mass | 203.15 |
| IUPAC Name | 3-hexa-1,3,4,5-tetraenyl-2-methyl-1,4,5,6,7,8-hexahydro-1,3-diazocin-3-ium |
| SMILES | C=C=C=CC=C/[N+]1=C(\C)NCCCCC1 |
| InChI | InChI=1S/C13H18N2/c1-3-4-5-8-11-15-12-9-6-7-10-14-13(15)2/h5,8,11H,1,6-7,9-10,12H2,2H3/p+1/b11-8?,14-13- |
| InChIKey | FMWIEQUZXWABOH-GBDBWQPRSA-O |
| XLogP | 2.20 |
| TPSA | 15.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 203.31 |
| LogP ≤ 5 | 2.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|