C33H21N3O2S+2 — CID 91804574
12'-phenylspiro[[1,3]benzothiazolo[3,2-c][1,3]benzoxazin-7-ium-6,6'-benzimidazolo[1,2-c][1,3]benzoxazin-7-ium] (PubChem CID 91804574) has the molecular formula C33H21N3O2S+2 and a molecular weight of 523.62 g/mol. Its IUPAC name is 12'-phenylspiro[[1,3]benzothiazolo[3,2-c][1,3]benzoxazin-7-ium-6,6'-benzimidazolo[1,2-c][1,3]benzoxazin-7-ium].
| Compound Name | 12'-phenylspiro[[1,3]benzothiazolo[3,2-c][1,3]benzoxazin-7-ium-6,6'-benzimidazolo[1,2-c][1,3]benzoxazin-7-ium] |
|---|---|
| PubChem CID | 91804574 |
| Molecular Formula | C33H21N3O2S+2 |
| Molecular Weight | 523.62 g/mol |
| Exact Mass | 523.13 |
| IUPAC Name | 12'-phenylspiro[[1,3]benzothiazolo[3,2-c][1,3]benzoxazin-7-ium-6,6'-benzimidazolo[1,2-c][1,3]benzoxazin-7-ium] |
| SMILES | c1ccc(-n2c3[n+](c4ccccc42)C2(Oc4ccccc4-c4sc5ccccc5[n+]42)Oc2ccccc2-3)cc1 |
| InChI | InChI=1S/C33H21N3O2S/c1-2-12-22(13-3-1)34-25-16-6-7-17-26(25)35-31(34)23-14-4-9-19-28(23)37-33(35)36-27-18-8-11-21-30(27)39-32(36)24-15-5-10-20-29(24)38-33/h1-21H/q+2 |
| InChIKey | FNACNBZZOVOVHI-UHFFFAOYSA-N |
| XLogP | 6.66 |
| TPSA | 31.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 523.62 |
| LogP ≤ 5 | 6.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|