About 3-methyl-6-propan-2-yl-4-(trifluoromethyl)-1,6-dihydropyrimidin-3-ium
3-methyl-6-propan-2-yl-4-(trifluoromethyl)-1,6-dihydropyrimidin-3-ium (PubChem CID 91804959) has the molecular formula C9H14F3N2+
and a molecular weight of 207.22 g/mol. Its IUPAC name is 3-methyl-6-propan-2-yl-4-(trifluoromethyl)-1,6-dihydropyrimidin-3-ium.
Molecular Properties
| Compound Name | 3-methyl-6-propan-2-yl-4-(trifluoromethyl)-1,6-dihydropyrimidin-3-ium |
| PubChem CID | 91804959 |
| Molecular Formula | C9H14F3N2+ |
| Molecular Weight | 207.22 g/mol |
| Exact Mass | 207.11 |
| IUPAC Name | 3-methyl-6-propan-2-yl-4-(trifluoromethyl)-1,6-dihydropyrimidin-3-ium |
| SMILES | CC(C)C1C=C(C(F)(F)F)[N+](C)=CN1 |
| InChI | InChI=1S/C9H13F3N2/c1-6(2)7-4-8(9(10,11)12)14(3)5-13-7/h4-7H,1-3H3/p+1 |
| InChIKey | ZGLOCHJAGLPTQA-UHFFFAOYSA-O |
| XLogP | 1.73 |
| TPSA | 15.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 207.22 |
| LogP ≤ 5 | 1.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|
Analyze 3-methyl-6-propan-2-yl-4-(trifluoromethyl)-1,6-dihydropyrimidin-3-ium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-methyl-6-propan-2-yl-4-(trifluoromethyl)-1,6-dihydropyrimidin-3-ium?
The IUPAC name of 3-methyl-6-propan-2-yl-4-(trifluoromethyl)-1,6-dihydropyrimidin-3-ium (CID 91804959) is 3-methyl-6-propan-2-yl-4-(trifluoromethyl)-1,6-dihydropyrimidin-3-ium.
What is the SMILES notation for 3-methyl-6-propan-2-yl-4-(trifluoromethyl)-1,6-dihydropyrimidin-3-ium?
The canonical SMILES for 3-methyl-6-propan-2-yl-4-(trifluoromethyl)-1,6-dihydropyrimidin-3-ium is CC(C)C1C=C(C(F)(F)F)[N+](C)=CN1.
What is the InChIKey of 3-methyl-6-propan-2-yl-4-(trifluoromethyl)-1,6-dihydropyrimidin-3-ium?
The InChIKey is ZGLOCHJAGLPTQA-UHFFFAOYSA-O. The full InChI is InChI=1S/C9H13F3N2/c1-6(2)7-4-8(9(10,11)12)14(3)5-13-7/h4-7H,1-3H3/p+1.
What are the key properties of 3-methyl-6-propan-2-yl-4-(trifluoromethyl)-1,6-dihydropyrimidin-3-ium?
3-methyl-6-propan-2-yl-4-(trifluoromethyl)-1,6-dihydropyrimidin-3-ium has a molecular weight of 207.22 g/mol, XLogP of 1.73, 1 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 3-methyl-6-propan-2-yl-4-(trifluoromethyl)-1,6-dihydropyrimidin-3-ium is sourced from PubChem (CID 91804959), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).