C31H36F3N4O2+ — CID 91805394
4-(2-methylphenyl)-N-(4-methylpiperazin-1-yl)-1-[[4-(2,4,5-trifluorophenoxy)phenyl]methyl]piperidin-1-ium-1-carboxamide (PubChem CID 91805394) has the molecular formula C31H36F3N4O2+ and a molecular weight of 553.65 g/mol. Its IUPAC name is 4-(2-methylphenyl)-N-(4-methylpiperazin-1-yl)-1-[[4-(2,4,5-trifluorophenoxy)phenyl]methyl]piperidin-1-ium-1-carboxamide.
| Compound Name | 4-(2-methylphenyl)-N-(4-methylpiperazin-1-yl)-1-[[4-(2,4,5-trifluorophenoxy)phenyl]methyl]piperidin-1-ium-1-carboxamide |
|---|---|
| PubChem CID | 91805394 |
| Molecular Formula | C31H36F3N4O2+ |
| Molecular Weight | 553.65 g/mol |
| Exact Mass | 553.28 |
| IUPAC Name | 4-(2-methylphenyl)-N-(4-methylpiperazin-1-yl)-1-[[4-(2,4,5-trifluorophenoxy)phenyl]methyl]piperidin-1-ium-1-carboxamide |
| SMILES | Cc1ccccc1C1CC[N+](Cc2ccc(Oc3cc(F)c(F)cc3F)cc2)(C(=O)NN2CCN(C)CC2)CC1 |
| InChI | InChI=1S/C31H35F3N4O2/c1-22-5-3-4-6-26(22)24-11-17-38(18-12-24,31(39)35-37-15-13-36(2)14-16-37)21-23-7-9-25(10-8-23)40-30-20-28(33)27(32)19-29(30)34/h3-10,19-20,24H,11-18,21H2,1-2H3/p+1 |
| InChIKey | QRGMABVVMZNDAQ-UHFFFAOYSA-O |
| XLogP | 5.97 |
| TPSA | 44.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 553.65 |
| LogP ≤ 5 | 5.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|