C9H10F2O3S — CID 91805708
[2-(difluoromethoxy)phenyl]methylidene-hydroxy-methyl-oxo-λ6-sulfane (PubChem CID 91805708) has the molecular formula C9H10F2O3S and a molecular weight of 236.24 g/mol. Its IUPAC name is [2-(difluoromethoxy)phenyl]methylidene-hydroxy-methyl-oxo-λ6-sulfane.
| Compound Name | [2-(difluoromethoxy)phenyl]methylidene-hydroxy-methyl-oxo-λ6-sulfane |
|---|---|
| PubChem CID | 91805708 |
| Molecular Formula | C9H10F2O3S |
| Molecular Weight | 236.24 g/mol |
| Exact Mass | 236.03 |
| IUPAC Name | [2-(difluoromethoxy)phenyl]methylidene-hydroxy-methyl-oxo-λ6-sulfane |
| SMILES | CS(=O)(O)=Cc1ccccc1OC(F)F |
| InChI | InChI=1S/C9H10F2O3S/c1-15(12,13)6-7-4-2-3-5-8(7)14-9(10)11/h2-6,9H,1H3,(H,12,13) |
| InChIKey | ZMPDKDDKGQIIOW-UHFFFAOYSA-N |
| XLogP | 1.83 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 236.24 |
| LogP ≤ 5 | 1.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'thio_aldehyd_A(3)', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|