About CID 91806063
CID 91806063 (PubChem CID 91806063) has the molecular formula C29H18F7O3S2+
and a molecular weight of 611.58 g/mol.
Molecular Properties
| Compound Name | CID 91806063 |
| PubChem CID | 91806063 |
| Molecular Formula | C29H18F7O3S2+ |
| Molecular Weight | 611.58 g/mol |
| Exact Mass | 611.06 |
| IUPAC Name | — |
| SMILES | O=C(O[S+](=C1C=CC2Oc3ccccc3C(=S)C2=C1)(c1ccccc1)c1ccccc1)C(F)(F)C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C29H18F7O3S2/c30-27(31,28(32,33)29(34,35)36)26(37)39-41(18-9-3-1-4-10-18,19-11-5-2-6-12-19)20-15-16-24-22(17-20)25(40)21-13-7-8-14-23(21)38-24/h1-17,24H/q+1 |
| InChIKey | LBXCTJOAYHOFRT-UHFFFAOYSA-N |
| XLogP | 7.40 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 41 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 611.58 |
| LogP ≤ 5 | 7.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'thio_ketone(43)', 'substructure': 'N/A'}, {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|
Analyze CID 91806063 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 91806063?
The IUPAC name of CID 91806063 (CID 91806063) is not available.
What is the SMILES notation for CID 91806063?
The canonical SMILES for CID 91806063 is O=C(O[S+](=C1C=CC2Oc3ccccc3C(=S)C2=C1)(c1ccccc1)c1ccccc1)C(F)(F)C(F)(F)C(F)(F)F.
What is the InChIKey of CID 91806063?
The InChIKey is LBXCTJOAYHOFRT-UHFFFAOYSA-N. The full InChI is InChI=1S/C29H18F7O3S2/c30-27(31,28(32,33)29(34,35)36)26(37)39-41(18-9-3-1-4-10-18,19-11-5-2-6-12-19)20-15-16-24-22(17-20)25(40)21-13-7-8-14-23(21)38-24/h1-17,24H/q+1.
What are the key properties of CID 91806063?
CID 91806063 has a molecular weight of 611.58 g/mol, XLogP of 7.40, 5 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for CID 91806063 is sourced from PubChem (CID 91806063), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).