About [4-(2,5-dihydroxypyrrol-1-yl)phenyl] sulfite
[4-(2,5-dihydroxypyrrol-1-yl)phenyl] sulfite (PubChem CID 91806069) has the molecular formula C10H8NO5S-
and a molecular weight of 254.24 g/mol. Its IUPAC name is [4-(2,5-dihydroxypyrrol-1-yl)phenyl] sulfite.
Molecular Properties
| Compound Name | [4-(2,5-dihydroxypyrrol-1-yl)phenyl] sulfite |
| PubChem CID | 91806069 |
| Molecular Formula | C10H8NO5S- |
| Molecular Weight | 254.24 g/mol |
| Exact Mass | 254.01 |
| IUPAC Name | [4-(2,5-dihydroxypyrrol-1-yl)phenyl] sulfite |
| SMILES | O=S([O-])Oc1ccc(-n2c(O)ccc2O)cc1 |
| InChI | InChI=1S/C10H9NO5S/c12-9-5-6-10(13)11(9)7-1-3-8(4-2-7)16-17(14)15/h1-6,12-13H,(H,14,15)/p-1 |
| InChIKey | ZLMGQLRMHZSFSJ-UHFFFAOYSA-M |
| XLogP | 1.06 |
| TPSA | 94.75 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 254.24 |
| LogP ≤ 5 | 1.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'sulfinic_acid', 'substructure': 'N/A'} |
|---|
Analyze [4-(2,5-dihydroxypyrrol-1-yl)phenyl] sulfite with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [4-(2,5-dihydroxypyrrol-1-yl)phenyl] sulfite?
The IUPAC name of [4-(2,5-dihydroxypyrrol-1-yl)phenyl] sulfite (CID 91806069) is [4-(2,5-dihydroxypyrrol-1-yl)phenyl] sulfite.
What is the SMILES notation for [4-(2,5-dihydroxypyrrol-1-yl)phenyl] sulfite?
The canonical SMILES for [4-(2,5-dihydroxypyrrol-1-yl)phenyl] sulfite is O=S([O-])Oc1ccc(-n2c(O)ccc2O)cc1.
What is the InChIKey of [4-(2,5-dihydroxypyrrol-1-yl)phenyl] sulfite?
The InChIKey is ZLMGQLRMHZSFSJ-UHFFFAOYSA-M. The full InChI is InChI=1S/C10H9NO5S/c12-9-5-6-10(13)11(9)7-1-3-8(4-2-7)16-17(14)15/h1-6,12-13H,(H,14,15)/p-1.
What are the key properties of [4-(2,5-dihydroxypyrrol-1-yl)phenyl] sulfite?
[4-(2,5-dihydroxypyrrol-1-yl)phenyl] sulfite has a molecular weight of 254.24 g/mol, XLogP of 1.06, 3 rotatable bonds, 2 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for [4-(2,5-dihydroxypyrrol-1-yl)phenyl] sulfite is sourced from PubChem (CID 91806069), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).