C11H13N3O2S — CID 91806187
4-(7-methoxy-[1,3]thiazolo[5,4-c]pyridin-4-yl)morpholine (PubChem CID 91806187) has the molecular formula C11H13N3O2S and a molecular weight of 251.31 g/mol. Its IUPAC name is 4-(7-methoxy-[1,3]thiazolo[5,4-c]pyridin-4-yl)morpholine.
| Compound Name | 4-(7-methoxy-[1,3]thiazolo[5,4-c]pyridin-4-yl)morpholine |
|---|---|
| PubChem CID | 91806187 |
| Molecular Formula | C11H13N3O2S |
| Molecular Weight | 251.31 g/mol |
| Exact Mass | 251.07 |
| IUPAC Name | 4-(7-methoxy-[1,3]thiazolo[5,4-c]pyridin-4-yl)morpholine |
| SMILES | COc1cnc(N2CCOCC2)c2scnc12 |
| InChI | InChI=1S/C11H13N3O2S/c1-15-8-6-12-11(10-9(8)13-7-17-10)14-2-4-16-5-3-14/h6-7H,2-5H2,1H3 |
| InChIKey | OBOKFUYLSVGAID-UHFFFAOYSA-N |
| XLogP | 1.54 |
| TPSA | 47.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 251.31 |
| LogP ≤ 5 | 1.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |