C12H18N3+ — CID 91806346
3-(aminomethyl)-2,2-dimethyl-1H-isoquinolin-2-ium-1-amine (PubChem CID 91806346) has the molecular formula C12H18N3+ and a molecular weight of 204.30 g/mol. Its IUPAC name is 3-(aminomethyl)-2,2-dimethyl-1H-isoquinolin-2-ium-1-amine.
| Compound Name | 3-(aminomethyl)-2,2-dimethyl-1H-isoquinolin-2-ium-1-amine |
|---|---|
| PubChem CID | 91806346 |
| Molecular Formula | C12H18N3+ |
| Molecular Weight | 204.30 g/mol |
| Exact Mass | 204.15 |
| IUPAC Name | 3-(aminomethyl)-2,2-dimethyl-1H-isoquinolin-2-ium-1-amine |
| SMILES | C[N+]1(C)C(CN)=Cc2ccccc2C1N |
| InChI | InChI=1S/C12H18N3/c1-15(2)10(8-13)7-9-5-3-4-6-11(9)12(15)14/h3-7,12H,8,13-14H2,1-2H3/q+1 |
| InChIKey | LKNXMDOOAFMUPW-UHFFFAOYSA-N |
| XLogP | 1.03 |
| TPSA | 52.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 204.30 |
| LogP ≤ 5 | 1.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|