About 3-hydroperoxy-2,6-dimethylocta-1,7-diene
3-hydroperoxy-2,6-dimethylocta-1,7-diene (PubChem CID 91806620) has the molecular formula C10H18O2
and a molecular weight of 170.25 g/mol. Its IUPAC name is 3-hydroperoxy-2,6-dimethylocta-1,7-diene.
Molecular Properties
| Compound Name | 3-hydroperoxy-2,6-dimethylocta-1,7-diene |
| PubChem CID | 91806620 |
| Molecular Formula | C10H18O2 |
| Molecular Weight | 170.25 g/mol |
| Exact Mass | 170.13 |
| IUPAC Name | 3-hydroperoxy-2,6-dimethylocta-1,7-diene |
| SMILES | C=CC(C)CCC(OO)C(=C)C |
| InChI | InChI=1S/C10H18O2/c1-5-9(4)6-7-10(12-11)8(2)3/h5,9-11H,1-2,6-7H2,3-4H3 |
| InChIKey | PDYLZXNQNFZDDH-UHFFFAOYSA-N |
| XLogP | 3.02 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 170.25 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|
Analyze 3-hydroperoxy-2,6-dimethylocta-1,7-diene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-hydroperoxy-2,6-dimethylocta-1,7-diene?
The IUPAC name of 3-hydroperoxy-2,6-dimethylocta-1,7-diene (CID 91806620) is 3-hydroperoxy-2,6-dimethylocta-1,7-diene.
What is the SMILES notation for 3-hydroperoxy-2,6-dimethylocta-1,7-diene?
The canonical SMILES for 3-hydroperoxy-2,6-dimethylocta-1,7-diene is C=CC(C)CCC(OO)C(=C)C.
What is the InChIKey of 3-hydroperoxy-2,6-dimethylocta-1,7-diene?
The InChIKey is PDYLZXNQNFZDDH-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H18O2/c1-5-9(4)6-7-10(12-11)8(2)3/h5,9-11H,1-2,6-7H2,3-4H3.
What are the key properties of 3-hydroperoxy-2,6-dimethylocta-1,7-diene?
3-hydroperoxy-2,6-dimethylocta-1,7-diene has a molecular weight of 170.25 g/mol, XLogP of 3.02, 6 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-hydroperoxy-2,6-dimethylocta-1,7-diene is sourced from PubChem (CID 91806620), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).