C18H31N3O3 — CID 91806899
tert-butyl N-[1-(2-cyanopyrrolidin-1-yl)-4-ethyl-1-oxohexan-3-yl]carbamate (PubChem CID 91806899) has the molecular formula C18H31N3O3 and a molecular weight of 337.46 g/mol. Its IUPAC name is tert-butyl N-[1-(2-cyanopyrrolidin-1-yl)-4-ethyl-1-oxohexan-3-yl]carbamate.
| Compound Name | tert-butyl N-[1-(2-cyanopyrrolidin-1-yl)-4-ethyl-1-oxohexan-3-yl]carbamate |
|---|---|
| PubChem CID | 91806899 |
| Molecular Formula | C18H31N3O3 |
| Molecular Weight | 337.46 g/mol |
| Exact Mass | 337.24 |
| IUPAC Name | tert-butyl N-[1-(2-cyanopyrrolidin-1-yl)-4-ethyl-1-oxohexan-3-yl]carbamate |
| SMILES | CCC(CC)C(CC(=O)N1CCCC1C#N)NC(=O)OC(C)(C)C |
| InChI | InChI=1S/C18H31N3O3/c1-6-13(7-2)15(20-17(23)24-18(3,4)5)11-16(22)21-10-8-9-14(21)12-19/h13-15H,6-11H2,1-5H3,(H,20,23) |
| InChIKey | WYXHTAYCYWESOT-UHFFFAOYSA-N |
| XLogP | 3.22 |
| TPSA | 82.43 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.46 |
| LogP ≤ 5 | 3.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |