About 2,4-dimethylpyrrol-1-ium
2,4-dimethylpyrrol-1-ium (PubChem CID 91807173) has the molecular formula C6H8N+
and a molecular weight of 94.14 g/mol. Its IUPAC name is 2,4-dimethylpyrrol-1-ium.
Molecular Properties
| Compound Name | 2,4-dimethylpyrrol-1-ium |
| PubChem CID | 91807173 |
| Molecular Formula | C6H8N+ |
| Molecular Weight | 94.14 g/mol |
| Exact Mass | 94.07 |
| IUPAC Name | 2,4-dimethylpyrrol-1-ium |
| SMILES | CC1=CC(C)=[N+]=C1 |
| InChI | InChI=1S/C6H8N/c1-5-3-6(2)7-4-5/h3-4H,1-2H3/q+1 |
| InChIKey | CAGCAQHLFCBYEL-UHFFFAOYSA-N |
| XLogP | 0.55 |
| TPSA | 14.10 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 7 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 94.14 |
| LogP ≤ 5 | 0.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|
Analyze 2,4-dimethylpyrrol-1-ium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,4-dimethylpyrrol-1-ium?
The IUPAC name of 2,4-dimethylpyrrol-1-ium (CID 91807173) is 2,4-dimethylpyrrol-1-ium.
What is the SMILES notation for 2,4-dimethylpyrrol-1-ium?
The canonical SMILES for 2,4-dimethylpyrrol-1-ium is CC1=CC(C)=[N+]=C1.
What is the InChIKey of 2,4-dimethylpyrrol-1-ium?
The InChIKey is CAGCAQHLFCBYEL-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H8N/c1-5-3-6(2)7-4-5/h3-4H,1-2H3/q+1.
What are the key properties of 2,4-dimethylpyrrol-1-ium?
2,4-dimethylpyrrol-1-ium has a molecular weight of 94.14 g/mol, XLogP of 0.55, 0 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 2,4-dimethylpyrrol-1-ium is sourced from PubChem (CID 91807173), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).