C2BrF4O2S- — CID 91807241
2-bromo-1,1,2,2-tetrafluoroethanesulfinate (PubChem CID 91807241) has the molecular formula C2BrF4O2S- and a molecular weight of 243.98 g/mol. Its IUPAC name is 2-bromo-1,1,2,2-tetrafluoroethanesulfinate.
| Compound Name | 2-bromo-1,1,2,2-tetrafluoroethanesulfinate |
|---|---|
| PubChem CID | 91807241 |
| Molecular Formula | C2BrF4O2S- |
| Molecular Weight | 243.98 g/mol |
| Exact Mass | 242.87 |
| IUPAC Name | 2-bromo-1,1,2,2-tetrafluoroethanesulfinate |
| SMILES | O=S([O-])C(F)(F)C(F)(F)Br |
| InChI | InChI=1S/C2HBrF4O2S/c3-1(4,5)2(6,7)10(8)9/h(H,8,9)/p-1 |
| InChIKey | AYZCBQGMNRGTCO-UHFFFAOYSA-M |
| XLogP | 1.45 |
| TPSA | 40.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 243.98 |
| LogP ≤ 5 | 1.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'}, {'alert_name': 'sulfinic_acid', 'substructure': 'N/A'} |
|---|