About 4-propylsulfonylbenzene-1,2-dicarbonitrile
4-propylsulfonylbenzene-1,2-dicarbonitrile (PubChem CID 91807711) has the molecular formula C11H10N2O2S
and a molecular weight of 234.28 g/mol. Its IUPAC name is 4-propylsulfonylbenzene-1,2-dicarbonitrile.
Molecular Properties
| Compound Name | 4-propylsulfonylbenzene-1,2-dicarbonitrile |
| PubChem CID | 91807711 |
| Molecular Formula | C11H10N2O2S |
| Molecular Weight | 234.28 g/mol |
| Exact Mass | 234.05 |
| IUPAC Name | 4-propylsulfonylbenzene-1,2-dicarbonitrile |
| SMILES | CCCS(=O)(=O)c1ccc(C#N)c(C#N)c1 |
| InChI | InChI=1S/C11H10N2O2S/c1-2-5-16(14,15)11-4-3-9(7-12)10(6-11)8-13/h3-4,6H,2,5H2,1H3 |
| InChIKey | QOCVCVZOZMNEOG-UHFFFAOYSA-N |
| XLogP | 1.61 |
| TPSA | 81.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 234.28 |
| LogP ≤ 5 | 1.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 4-propylsulfonylbenzene-1,2-dicarbonitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-propylsulfonylbenzene-1,2-dicarbonitrile?
The IUPAC name of 4-propylsulfonylbenzene-1,2-dicarbonitrile (CID 91807711) is 4-propylsulfonylbenzene-1,2-dicarbonitrile.
What is the SMILES notation for 4-propylsulfonylbenzene-1,2-dicarbonitrile?
The canonical SMILES for 4-propylsulfonylbenzene-1,2-dicarbonitrile is CCCS(=O)(=O)c1ccc(C#N)c(C#N)c1.
What is the InChIKey of 4-propylsulfonylbenzene-1,2-dicarbonitrile?
The InChIKey is QOCVCVZOZMNEOG-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H10N2O2S/c1-2-5-16(14,15)11-4-3-9(7-12)10(6-11)8-13/h3-4,6H,2,5H2,1H3.
What are the key properties of 4-propylsulfonylbenzene-1,2-dicarbonitrile?
4-propylsulfonylbenzene-1,2-dicarbonitrile has a molecular weight of 234.28 g/mol, XLogP of 1.61, 3 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 4-propylsulfonylbenzene-1,2-dicarbonitrile is sourced from PubChem (CID 91807711), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).