C10H7F2N3O3S — CID 91807841
4-[(4,6-difluoropyrimidin-2-yl)amino]benzenesulfonic acid (PubChem CID 91807841) has the molecular formula C10H7F2N3O3S and a molecular weight of 287.25 g/mol. Its IUPAC name is 4-[(4,6-difluoropyrimidin-2-yl)amino]benzenesulfonic acid.
| Compound Name | 4-[(4,6-difluoropyrimidin-2-yl)amino]benzenesulfonic acid |
|---|---|
| PubChem CID | 91807841 |
| Molecular Formula | C10H7F2N3O3S |
| Molecular Weight | 287.25 g/mol |
| Exact Mass | 287.02 |
| IUPAC Name | 4-[(4,6-difluoropyrimidin-2-yl)amino]benzenesulfonic acid |
| SMILES | O=S(=O)(O)c1ccc(Nc2nc(F)cc(F)n2)cc1 |
| InChI | InChI=1S/C10H7F2N3O3S/c11-8-5-9(12)15-10(14-8)13-6-1-3-7(4-2-6)19(16,17)18/h1-5H,(H,13,14,15)(H,16,17,18) |
| InChIKey | IHVZIVQTFRDBDN-UHFFFAOYSA-N |
| XLogP | 1.75 |
| TPSA | 92.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.25 |
| LogP ≤ 5 | 1.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|