C20H42O — CID 91807952
5,6-dibutyldodecan-5-ol (PubChem CID 91807952) has the molecular formula C20H42O and a molecular weight of 298.56 g/mol. Its IUPAC name is 5,6-dibutyldodecan-5-ol.
| Compound Name | 5,6-dibutyldodecan-5-ol |
|---|---|
| PubChem CID | 91807952 |
| Molecular Formula | C20H42O |
| Molecular Weight | 298.56 g/mol |
| Exact Mass | 298.32 |
| IUPAC Name | 5,6-dibutyldodecan-5-ol |
| SMILES | CCCCCCC(CCCC)C(O)(CCCC)CCCC |
| InChI | InChI=1S/C20H42O/c1-5-9-13-14-16-19(15-10-6-2)20(21,17-11-7-3)18-12-8-4/h19,21H,5-18H2,1-4H3 |
| InChIKey | CYEGXGTTWBVHAU-UHFFFAOYSA-N |
| XLogP | 6.87 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.56 |
| LogP ≤ 5 | 6.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|