C22H27F2N5O2S — CID 91808120
N-[3-(dimethylamino)propyl]-4-[4-fluoro-2-(2-fluoropropoxy)anilino]-5-methylthieno[2,3-d]pyrimidine-6-carboxamide (PubChem CID 91808120) has the molecular formula C22H27F2N5O2S and a molecular weight of 463.55 g/mol. Its IUPAC name is N-[3-(dimethylamino)propyl]-4-[4-fluoro-2-(2-fluoropropoxy)anilino]-5-methylthieno[2,3-d]pyrimidine-6-carboxamide.
| Compound Name | N-[3-(dimethylamino)propyl]-4-[4-fluoro-2-(2-fluoropropoxy)anilino]-5-methylthieno[2,3-d]pyrimidine-6-carboxamide |
|---|---|
| PubChem CID | 91808120 |
| Molecular Formula | C22H27F2N5O2S |
| Molecular Weight | 463.55 g/mol |
| Exact Mass | 463.19 |
| IUPAC Name | N-[3-(dimethylamino)propyl]-4-[4-fluoro-2-(2-fluoropropoxy)anilino]-5-methylthieno[2,3-d]pyrimidine-6-carboxamide |
| SMILES | Cc1c(C(=O)NCCCN(C)C)sc2ncnc(Nc3ccc(F)cc3OCC(C)F)c12 |
| InChI | InChI=1S/C22H27F2N5O2S/c1-13(23)11-31-17-10-15(24)6-7-16(17)28-20-18-14(2)19(32-22(18)27-12-26-20)21(30)25-8-5-9-29(3)4/h6-7,10,12-13H,5,8-9,11H2,1-4H3,(H,25,30)(H,26,27,28) |
| InChIKey | MUMDPLOSBRNDKV-UHFFFAOYSA-N |
| XLogP | 4.30 |
| TPSA | 79.38 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 463.55 |
| LogP ≤ 5 | 4.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|