C30H34N2O5 — CID 91808202
4-[4-(hydroxymethyl)benzoyl]-5-nonan-5-yl-1-[4-(1,2-oxazol-3-yl)phenyl]pyrrolidine-2,3-dione (PubChem CID 91808202) has the molecular formula C30H34N2O5 and a molecular weight of 502.61 g/mol. Its IUPAC name is 4-[4-(hydroxymethyl)benzoyl]-5-nonan-5-yl-1-[4-(1,2-oxazol-3-yl)phenyl]pyrrolidine-2,3-dione.
| Compound Name | 4-[4-(hydroxymethyl)benzoyl]-5-nonan-5-yl-1-[4-(1,2-oxazol-3-yl)phenyl]pyrrolidine-2,3-dione |
|---|---|
| PubChem CID | 91808202 |
| Molecular Formula | C30H34N2O5 |
| Molecular Weight | 502.61 g/mol |
| Exact Mass | 502.25 |
| IUPAC Name | 4-[4-(hydroxymethyl)benzoyl]-5-nonan-5-yl-1-[4-(1,2-oxazol-3-yl)phenyl]pyrrolidine-2,3-dione |
| SMILES | CCCCC(CCCC)C1C(C(=O)c2ccc(CO)cc2)C(=O)C(=O)N1c1ccc(-c2ccon2)cc1 |
| InChI | InChI=1S/C30H34N2O5/c1-3-5-7-22(8-6-4-2)27-26(28(34)23-11-9-20(19-33)10-12-23)29(35)30(36)32(27)24-15-13-21(14-16-24)25-17-18-37-31-25/h9-18,22,26-27,33H,3-8,19H2,1-2H3 |
| InChIKey | DLBSADYRTNZKDY-UHFFFAOYSA-N |
| XLogP | 5.61 |
| TPSA | 100.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 502.61 |
| LogP ≤ 5 | 5.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|