C22H15F3N2O5 — CID 91808205
5-(2-methoxyphenyl)-1-[4-(1,2-oxazol-3-yl)phenyl]-4-(2,2,2-trifluoroacetyl)pyrrolidine-2,3-dione (PubChem CID 91808205) has the molecular formula C22H15F3N2O5 and a molecular weight of 444.37 g/mol. Its IUPAC name is 5-(2-methoxyphenyl)-1-[4-(1,2-oxazol-3-yl)phenyl]-4-(2,2,2-trifluoroacetyl)pyrrolidine-2,3-dione.
| Compound Name | 5-(2-methoxyphenyl)-1-[4-(1,2-oxazol-3-yl)phenyl]-4-(2,2,2-trifluoroacetyl)pyrrolidine-2,3-dione |
|---|---|
| PubChem CID | 91808205 |
| Molecular Formula | C22H15F3N2O5 |
| Molecular Weight | 444.37 g/mol |
| Exact Mass | 444.09 |
| IUPAC Name | 5-(2-methoxyphenyl)-1-[4-(1,2-oxazol-3-yl)phenyl]-4-(2,2,2-trifluoroacetyl)pyrrolidine-2,3-dione |
| SMILES | COc1ccccc1C1C(C(=O)C(F)(F)F)C(=O)C(=O)N1c1ccc(-c2ccon2)cc1 |
| InChI | InChI=1S/C22H15F3N2O5/c1-31-16-5-3-2-4-14(16)18-17(20(29)22(23,24)25)19(28)21(30)27(18)13-8-6-12(7-9-13)15-10-11-32-26-15/h2-11,17-18H,1H3 |
| InChIKey | XYWTWQRTNSXXMQ-UHFFFAOYSA-N |
| XLogP | 3.75 |
| TPSA | 89.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.37 |
| LogP ≤ 5 | 3.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|